C22H21ClN2S — CID 133218243
1-(3-chlorophenyl)-3-[(2,4-dimethylphenyl)-phenylmethyl]thiourea (PubChem CID 133218243) has the molecular formula C22H21ClN2S and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(2,4-dimethylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(2,4-dimethylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 133218243 |
| Molecular Formula | C22H21ClN2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(2,4-dimethylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1ccc(C(NC(=S)Nc2cccc(Cl)c2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H21ClN2S/c1-15-11-12-20(16(2)13-15)21(17-7-4-3-5-8-17)25-22(26)24-19-10-6-9-18(23)14-19/h3-14,21H,1-2H3,(H2,24,25,26) |
| InChIKey | WAPKXHDERMYYGV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|