C22H23N3S — CID 100747851
1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 100747851) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100747851 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc([C@H](NC(=S)Nc2cccc(C)n2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H23N3S/c1-15-12-13-19(16(2)14-15)21(18-9-5-4-6-10-18)25-22(26)24-20-11-7-8-17(3)23-20/h4-14,21H,1-3H3,(H2,23,24,25,26)/t21-/m1/s1 |
| InChIKey | HWMAODTZCQWBJH-OAQYLSRUSA-N |
| XLogP | 5.08 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|