C23H21F3N2S — CID 100747576
1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100747576) has the molecular formula C23H21F3N2S and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100747576 |
| Molecular Formula | C23H21F3N2S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)Nc2ccc(C(F)(F)F)cc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H21F3N2S/c1-15-8-13-20(16(2)14-15)21(17-6-4-3-5-7-17)28-22(29)27-19-11-9-18(10-12-19)23(24,25)26/h3-14,21H,1-2H3,(H2,27,28,29)/t21-/m0/s1 |
| InChIKey | WQLVBJWMHZPDQK-NRFANRHFSA-N |
| XLogP | 6.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|