C21H20N2S — CID 92646547
1-[(R)-(2-methylphenyl)-phenylmethyl]-3-phenylthiourea (PubChem CID 92646547) has the molecular formula C21H20N2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[(R)-(2-methylphenyl)-phenylmethyl]-3-phenylthiourea.
| Compound Name | 1-[(R)-(2-methylphenyl)-phenylmethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 92646547 |
| Molecular Formula | C21H20N2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[(R)-(2-methylphenyl)-phenylmethyl]-3-phenylthiourea |
| SMILES | Cc1ccccc1[C@H](NC(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2S/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)23-21(24)22-18-13-6-3-7-14-18/h2-15,20H,1H3,(H2,22,23,24)/t20-/m1/s1 |
| InChIKey | DFSHYCINQZXTRU-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|