C23H25N3O2S2 — CID 100658733
1-[3-[methyl(methylsulfonyl)amino]phenyl]-3-[(S)-(2-methylphenyl)-phenylmethyl]thiourea (PubChem CID 100658733) has the molecular formula C23H25N3O2S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 1-[3-[methyl(methylsulfonyl)amino]phenyl]-3-[(S)-(2-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-[3-[methyl(methylsulfonyl)amino]phenyl]-3-[(S)-(2-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 100658733 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-[3-[methyl(methylsulfonyl)amino]phenyl]-3-[(S)-(2-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1ccccc1[C@@H](NC(=S)Nc1cccc(N(C)S(C)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O2S2/c1-17-10-7-8-15-21(17)22(18-11-5-4-6-12-18)25-23(29)24-19-13-9-14-20(16-19)26(2)30(3,27)28/h4-16,22H,1-3H3,(H2,24,25,29)/t22-/m0/s1 |
| InChIKey | YWEJQXZXODSZGS-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|