C20H19N3S — CID 133215757
1-[(2-methylphenyl)-phenylmethyl]-3-pyridin-3-ylthiourea (PubChem CID 133215757) has the molecular formula C20H19N3S and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-[(2-methylphenyl)-phenylmethyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[(2-methylphenyl)-phenylmethyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 133215757 |
| Molecular Formula | C20H19N3S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[(2-methylphenyl)-phenylmethyl]-3-pyridin-3-ylthiourea |
| SMILES | Cc1ccccc1C(NC(=S)Nc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3S/c1-15-8-5-6-12-18(15)19(16-9-3-2-4-10-16)23-20(24)22-17-11-7-13-21-14-17/h2-14,19H,1H3,(H2,22,23,24) |
| InChIKey | MCUAWHVUQJIXBI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|