C20H17Cl2N3S — CID 91086354
1-(2,3-dichlorophenyl)-3-[(2-methylphenyl)-pyridin-3-ylmethyl]thiourea (PubChem CID 91086354) has the molecular formula C20H17Cl2N3S and a molecular weight of 402.35 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[(2-methylphenyl)-pyridin-3-ylmethyl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[(2-methylphenyl)-pyridin-3-ylmethyl]thiourea |
|---|---|
| PubChem CID | 91086354 |
| Molecular Formula | C20H17Cl2N3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[(2-methylphenyl)-pyridin-3-ylmethyl]thiourea |
| SMILES | Cc1ccccc1C(NC(=S)Nc1cccc(Cl)c1Cl)c1cccnc1 |
| InChI | InChI=1S/C20H17Cl2N3S/c1-13-6-2-3-8-15(13)19(14-7-5-11-23-12-14)25-20(26)24-17-10-4-9-16(21)18(17)22/h2-12,19H,1H3,(H2,24,25,26) |
| InChIKey | PZTAXZIUKQWNRY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|