C20H18ClN3S — CID 9232692
1-(3-chloro-2-methylphenyl)-3-[(S)-phenyl(pyridin-4-yl)methyl]thiourea (PubChem CID 9232692) has the molecular formula C20H18ClN3S and a molecular weight of 367.91 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(S)-phenyl(pyridin-4-yl)methyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(S)-phenyl(pyridin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 9232692 |
| Molecular Formula | C20H18ClN3S |
| Molecular Weight | 367.91 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(S)-phenyl(pyridin-4-yl)methyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N[C@@H](c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C20H18ClN3S/c1-14-17(21)8-5-9-18(14)23-20(25)24-19(15-6-3-2-4-7-15)16-10-12-22-13-11-16/h2-13,19H,1H3,(H2,23,24,25)/t19-/m0/s1 |
| InChIKey | DSZBJTNPHVZLLT-IBGZPJMESA-N |
| XLogP | 5.12 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|