C16H16Cl2N2S — CID 8676120
1-(3-chloro-2-methylphenyl)-3-[(1R)-1-(3-chlorophenyl)ethyl]thiourea (PubChem CID 8676120) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(1R)-1-(3-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(1R)-1-(3-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8676120 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(1R)-1-(3-chlorophenyl)ethyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N[C@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2S/c1-10-14(18)7-4-8-15(10)20-16(21)19-11(2)12-5-3-6-13(17)9-12/h3-9,11H,1-2H3,(H2,19,20,21)/t11-/m1/s1 |
| InChIKey | QTCFQKJRTNFHFO-LLVKDONJSA-N |
| XLogP | 5.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|