C22H29ClN4S — CID 2149814
1-(3-chloro-2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea (PubChem CID 2149814) has the molecular formula C22H29ClN4S and a molecular weight of 417.02 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2149814 |
| Molecular Formula | C22H29ClN4S |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N[C@H](C)[C@H](c1ccccc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H29ClN4S/c1-16-19(23)10-7-11-20(16)25-22(28)24-17(2)21(18-8-5-4-6-9-18)27-14-12-26(3)13-15-27/h4-11,17,21H,12-15H2,1-3H3,(H2,24,25,28)/t17-,21-/m1/s1 |
| InChIKey | XZTFFADPXVZPGM-DYESRHJHSA-N |
| XLogP | 4.31 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|