C21H27BrN4S — CID 5002179
1-(4-bromophenyl)-3-[1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea (PubChem CID 5002179) has the molecular formula C21H27BrN4S and a molecular weight of 447.45 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 5002179 |
| Molecular Formula | C21H27BrN4S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(4-bromophenyl)-3-[1-(4-methylpiperazin-1-yl)-1-phenylpropan-2-yl]thiourea |
| SMILES | CC(NC(=S)Nc1ccc(Br)cc1)C(c1ccccc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H27BrN4S/c1-16(23-21(27)24-19-10-8-18(22)9-11-19)20(17-6-4-3-5-7-17)26-14-12-25(2)13-15-26/h3-11,16,20H,12-15H2,1-2H3,(H2,23,24,27) |
| InChIKey | BBNVNNBGIQAVNB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|