C18H22BrN3OS2 — CID 30889189
1-(4-bromophenyl)-3-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 30889189) has the molecular formula C18H22BrN3OS2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 30889189 |
| Molecular Formula | C18H22BrN3OS2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc(Br)cc1)[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C18H22BrN3OS2/c1-13(20-18(24)21-15-6-4-14(19)5-7-15)17(16-3-2-12-25-16)22-8-10-23-11-9-22/h2-7,12-13,17H,8-11H2,1H3,(H2,20,21,24)/t13-,17+/m1/s1 |
| InChIKey | VWUIVLIQRYZKBQ-DYVFJYSZSA-N |
| XLogP | 4.26 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|