C19H24ClN3OS2 — CID 16806613
1-(3-chloro-2-methylphenyl)-3-(1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl)thiourea (PubChem CID 16806613) has the molecular formula C19H24ClN3OS2 and a molecular weight of 410.01 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-(1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl)thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-(1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl)thiourea |
|---|---|
| PubChem CID | 16806613 |
| Molecular Formula | C19H24ClN3OS2 |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-(1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl)thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)NC(C)C(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C19H24ClN3OS2/c1-13-15(20)5-3-6-16(13)22-19(25)21-14(2)18(17-7-4-12-26-17)23-8-10-24-11-9-23/h3-7,12,14,18H,8-11H2,1-2H3,(H2,21,22,25) |
| InChIKey | KYVPUCRHAMYDNV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|