C22H32N4S2 — CID 7086808
1-(2,3-dimethylphenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 7086808) has the molecular formula C22H32N4S2 and a molecular weight of 416.66 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 7086808 |
| Molecular Formula | C22H32N4S2 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@H](C)NC(=S)Nc2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C22H32N4S2/c1-5-25-11-13-26(14-12-25)21(20-10-7-15-28-20)18(4)23-22(27)24-19-9-6-8-16(2)17(19)3/h6-10,15,18,21H,5,11-14H2,1-4H3,(H2,23,24,27)/t18-,21-/m0/s1 |
| InChIKey | OCGCHENCXSGMAE-RXVVDRJESA-N |
| XLogP | 4.42 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|