C19H27N3OS2 — CID 6710505
N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 6710505) has the molecular formula C19H27N3OS2 and a molecular weight of 377.58 g/mol. Its IUPAC name is N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 6710505 |
| Molecular Formula | C19H27N3OS2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | CCN1CCN(C(c2cccs2)C(C)NC(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C19H27N3OS2/c1-3-21-8-10-22(11-9-21)19(17-7-5-13-25-17)15(2)20-18(23)14-16-6-4-12-24-16/h4-7,12-13,15,19H,3,8-11,14H2,1-2H3,(H,20,23) |
| InChIKey | ZNSJQNXKNGIMFP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |