C21H34N4O2S — CID 7110700
N-cyclohexyl-N'-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 7110700) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-cyclohexyl-N'-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 7110700 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-cyclohexyl-N'-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@H](C)NC(=O)C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H34N4O2S/c1-3-24-11-13-25(14-12-24)19(18-10-7-15-28-18)16(2)22-20(26)21(27)23-17-8-5-4-6-9-17/h7,10,15-17,19H,3-6,8-9,11-14H2,1-2H3,(H,22,26)(H,23,27)/t16-,19-/m0/s1 |
| InChIKey | TZYWEABBBFIBJV-LPHOPBHVSA-N |
| XLogP | 2.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|