C21H29N5O2S — CID 92665861
N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 92665861) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 92665861 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@@H](C)NC(=O)C(=O)NCc2ccccn2)CC1 |
| InChI | InChI=1S/C21H29N5O2S/c1-3-25-10-12-26(13-11-25)19(18-8-6-14-29-18)16(2)24-21(28)20(27)23-15-17-7-4-5-9-22-17/h4-9,14,16,19H,3,10-13,15H2,1-2H3,(H,23,27)(H,24,28)/t16-,19+/m1/s1 |
| InChIKey | IEHCRUOJAPJVQH-APWZRJJASA-N |
| XLogP | 1.64 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|