C25H33N5O2S — CID 28820930
N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 28820930) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 28820930 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@@H](C)NC(=O)C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H33N5O2S/c1-3-29-12-14-30(15-13-29)23(22-9-6-16-33-22)18(2)28-25(32)24(31)26-11-10-19-17-27-21-8-5-4-7-20(19)21/h4-9,16-18,23,27H,3,10-15H2,1-2H3,(H,26,31)(H,28,32)/t18-,23+/m1/s1 |
| InChIKey | BLYAMWGFLGFKHB-JPYJTQIMSA-N |
| XLogP | 2.77 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|