C23H28N4O3S — CID 28820719
N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28820719) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28820719 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCCc1c[nH]c2ccccc12)[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C23H28N4O3S/c1-16(21(20-7-4-14-31-20)27-10-12-30-13-11-27)26-23(29)22(28)24-9-8-17-15-25-19-6-3-2-5-18(17)19/h2-7,14-16,21,25H,8-13H2,1H3,(H,24,28)(H,26,29)/t16-,21+/m1/s1 |
| InChIKey | NGFAFQGHCYPTSV-IERDGZPVSA-N |
| XLogP | 2.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|