C29H33N5O2S — CID 20866396
N-[2-(1H-indol-3-yl)ethyl]-N'-[1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 20866396) has the molecular formula C29H33N5O2S and a molecular weight of 515.68 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 20866396 |
| Molecular Formula | C29H33N5O2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | CC(NC(=O)C(=O)NCCc1c[nH]c2ccccc12)C(c1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H33N5O2S/c1-21(32-29(36)28(35)30-14-13-22-20-31-25-11-6-5-10-24(22)25)27(26-12-7-19-37-26)34-17-15-33(16-18-34)23-8-3-2-4-9-23/h2-12,19-21,27,31H,13-18H2,1H3,(H,30,35)(H,32,36) |
| InChIKey | GAPWIHOBWPCSNE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|