C26H29ClN4O2S — CID 28821090
N-[(2-chlorophenyl)methyl]-N'-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28821090) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28821090 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCc1ccccc1Cl)[C@H](c1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29ClN4O2S/c1-19(29-26(33)25(32)28-18-20-8-5-6-11-22(20)27)24(23-12-7-17-34-23)31-15-13-30(14-16-31)21-9-3-2-4-10-21/h2-12,17,19,24H,13-16,18H2,1H3,(H,28,32)(H,29,33)/t19-,24+/m0/s1 |
| InChIKey | HPMSDHSJRLGHSD-YADARESESA-N |
| XLogP | 4.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|