C28H34N4O4S — CID 28821390
N-[(2-methoxyphenyl)methyl]-N'-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28821390) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-N'-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-N'-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28821390 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-N'-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccc(N2CCN([C@@H](c3cccs3)[C@@H](C)NC(=O)C(=O)NCc3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O4S/c1-20(30-28(34)27(33)29-19-21-7-4-5-8-24(21)36-3)26(25-9-6-18-37-25)32-16-14-31(15-17-32)22-10-12-23(35-2)13-11-22/h4-13,18,20,26H,14-17,19H2,1-3H3,(H,29,33)(H,30,34)/t20-,26-/m1/s1 |
| InChIKey | HJXORNLTGJUSBR-FQRUVTKNSA-N |
| XLogP | 3.45 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|