C28H32N4O5S — CID 20866494
N-(1,3-benzodioxol-5-ylmethyl)-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 20866494) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 20866494 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccc(N2CCN(C(c3cccs3)C(C)NC(=O)C(=O)NCc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C28H32N4O5S/c1-19(30-28(34)27(33)29-17-20-5-10-23-24(16-20)37-18-36-23)26(25-4-3-15-38-25)32-13-11-31(12-14-32)21-6-8-22(35-2)9-7-21/h3-10,15-16,19,26H,11-14,17-18H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | QEIKSQFMJIFCMS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|