C24H35N5O3S — CID 20866486
N-[2-(dimethylamino)ethyl]-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 20866486) has the molecular formula C24H35N5O3S and a molecular weight of 473.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 20866486 |
| Molecular Formula | C24H35N5O3S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccc(N2CCN(C(c3cccs3)C(C)NC(=O)C(=O)NCCN(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H35N5O3S/c1-18(26-24(31)23(30)25-11-12-27(2)3)22(21-6-5-17-33-21)29-15-13-28(14-16-29)19-7-9-20(32-4)10-8-19/h5-10,17-18,22H,11-16H2,1-4H3,(H,25,30)(H,26,31) |
| InChIKey | NFCWHGBCNUIEDI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|