C26H31N3O3S — CID 41144088
4-methoxy-N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide (PubChem CID 41144088) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 4-methoxy-N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 41144088 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-methoxy-N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C)[C@@H](c2cccs2)N2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-19(27-26(30)20-6-10-22(31-2)11-7-20)25(24-5-4-18-33-24)29-16-14-28(15-17-29)21-8-12-23(32-3)13-9-21/h4-13,18-19,25H,14-17H2,1-3H3,(H,27,30)/t19-,25+/m1/s1 |
| InChIKey | QGDJDJHPIKVYOH-CLOONOSVSA-N |
| XLogP | 4.45 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|