C28H35N3O5S — CID 41144108
3,4,5-trimethoxy-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide (PubChem CID 41144108) has the molecular formula C28H35N3O5S and a molecular weight of 525.67 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 41144108 |
| Molecular Formula | C28H35N3O5S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]benzamide |
| SMILES | COc1ccc(N2CCN([C@@H](c3cccs3)[C@@H](C)NC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O5S/c1-19(29-28(32)20-17-23(34-3)27(36-5)24(18-20)35-4)26(25-7-6-16-37-25)31-14-12-30(13-15-31)21-8-10-22(33-2)11-9-21/h6-11,16-19,26H,12-15H2,1-5H3,(H,29,32)/t19-,26-/m1/s1 |
| InChIKey | XYYBPNFJZVZWQP-NIYFSFCBSA-N |
| XLogP | 4.46 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|