C24H34N4O3S — CID 28821326
N',N'-diethyl-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28821326) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is N',N'-diethyl-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N',N'-diethyl-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28821326 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N',N'-diethyl-N-[(1R,2R)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | CCN(CC)C(=O)C(=O)N[C@H](C)[C@H](c1cccs1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H34N4O3S/c1-5-26(6-2)24(30)23(29)25-18(3)22(21-8-7-17-32-21)28-15-13-27(14-16-28)19-9-11-20(31-4)12-10-19/h7-12,17-18,22H,5-6,13-16H2,1-4H3,(H,25,29)/t18-,22-/m1/s1 |
| InChIKey | OXVJYAJGAKUZMJ-XMSQKQJNSA-N |
| XLogP | 2.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|