C23H31FN4O2S — CID 28821171
N',N'-diethyl-N-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28821171) has the molecular formula C23H31FN4O2S and a molecular weight of 446.59 g/mol. Its IUPAC name is N',N'-diethyl-N-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N',N'-diethyl-N-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28821171 |
| Molecular Formula | C23H31FN4O2S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N',N'-diethyl-N-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | CCN(CC)C(=O)C(=O)N[C@H](C)[C@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H31FN4O2S/c1-4-26(5-2)23(30)22(29)25-17(3)21(20-11-8-16-31-20)28-14-12-27(13-15-28)19-10-7-6-9-18(19)24/h6-11,16-17,21H,4-5,12-15H2,1-3H3,(H,25,29)/t17-,21-/m1/s1 |
| InChIKey | SJCXPURLDLYPHD-DYESRHJHSA-N |
| XLogP | 3.12 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|