C27H31FN4O3S — CID 92665962
N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[(2-methoxyphenyl)methyl]oxamide (PubChem CID 92665962) has the molecular formula C27H31FN4O3S and a molecular weight of 510.64 g/mol. Its IUPAC name is N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[(2-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[(2-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 92665962 |
| Molecular Formula | C27H31FN4O3S |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[(2-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccccc1CNC(=O)C(=O)N[C@@H](C)[C@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H31FN4O3S/c1-19(30-27(34)26(33)29-18-20-8-3-6-11-23(20)35-2)25(24-12-7-17-36-24)32-15-13-31(14-16-32)22-10-5-4-9-21(22)28/h3-12,17,19,25H,13-16,18H2,1-2H3,(H,29,33)(H,30,34)/t19-,25+/m0/s1 |
| InChIKey | PWIBHFIZCUXBIM-UQBPGWFLSA-N |
| XLogP | 3.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|