C25H28FN5O2S — CID 20866441
N'-[1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 20866441) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is N'-[1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 20866441 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N'-[1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCc1cccnc1)C(c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H28FN5O2S/c1-18(29-25(33)24(32)28-17-19-6-4-10-27-16-19)23(22-9-5-15-34-22)31-13-11-30(12-14-31)21-8-3-2-7-20(21)26/h2-10,15-16,18,23H,11-14,17H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | CNJPDAUJLBGSDY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|