C19H24N4O3S — CID 92665752
N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 92665752) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 92665752 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-[(1S,2R)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCc1cccnc1)[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C19H24N4O3S/c1-14(17(16-5-3-11-27-16)23-7-9-26-10-8-23)22-19(25)18(24)21-13-15-4-2-6-20-12-15/h2-6,11-12,14,17H,7-10,13H2,1H3,(H,21,24)(H,22,25)/t14-,17+/m1/s1 |
| InChIKey | YWYNJWDRSFBNCT-PBHICJAKSA-N |
| XLogP | 1.34 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|