C26H37N5O3S — CID 92766668
N'-[(1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 92766668) has the molecular formula C26H37N5O3S and a molecular weight of 499.68 g/mol. Its IUPAC name is N'-[(1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[(1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 92766668 |
| Molecular Formula | C26H37N5O3S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N'-[(1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCCN1CCOCC1)[C@@H](c1cccs1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H37N5O3S/c1-21(28-26(33)25(32)27-9-10-29-15-17-34-18-16-29)24(23-8-5-19-35-23)31-13-11-30(12-14-31)20-22-6-3-2-4-7-22/h2-8,19,21,24H,9-18,20H2,1H3,(H,27,32)(H,28,33)/t21-,24-/m0/s1 |
| InChIKey | IXSCCTHVLGDIGQ-URXFXBBRSA-N |
| XLogP | 1.56 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|