C23H27N3OS2 — CID 3245545
N-[1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiophene-2-carboxamide (PubChem CID 3245545) has the molecular formula C23H27N3OS2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3245545 |
| Molecular Formula | C23H27N3OS2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(c1cccs1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N3OS2/c1-18(24-23(27)21-10-6-16-29-21)22(20-9-5-15-28-20)26-13-11-25(12-14-26)17-19-7-3-2-4-8-19/h2-10,15-16,18,22H,11-14,17H2,1H3,(H,24,27) |
| InChIKey | RAGAQGITTWHNKI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |