C18H25N3S — CID 51613857
(1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine (PubChem CID 51613857) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is (1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine.
| Compound Name | (1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 51613857 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (1S,2S)-1-(4-benzylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine |
| SMILES | C[C@H](N)[C@@H](c1cccs1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3S/c1-15(19)18(17-8-5-13-22-17)21-11-9-20(10-12-21)14-16-6-3-2-4-7-16/h2-8,13,15,18H,9-12,14,19H2,1H3/t15-,18-/m0/s1 |
| InChIKey | XSKAVNAYEIVLKN-YJBOKZPZSA-N |
| XLogP | 2.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |