C15H28N4S — CID 62886596
1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-1-thiophen-2-ylpropan-2-amine (PubChem CID 62886596) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-1-thiophen-2-ylpropan-2-amine.
| Compound Name | 1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 62886596 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-1-thiophen-2-ylpropan-2-amine |
| SMILES | CC(N)C(c1cccs1)N1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C15H28N4S/c1-13(16)15(14-5-4-12-20-14)19-10-8-18(9-11-19)7-6-17(2)3/h4-5,12-13,15H,6-11,16H2,1-3H3 |
| InChIKey | RKROKLISHJMVGO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |