C13H23N3S — CID 113279389
2-(4-propan-2-ylpiperazin-1-yl)-1-thiophen-2-ylethanamine (PubChem CID 113279389) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-(4-propan-2-ylpiperazin-1-yl)-1-thiophen-2-ylethanamine.
| Compound Name | 2-(4-propan-2-ylpiperazin-1-yl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 113279389 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(4-propan-2-ylpiperazin-1-yl)-1-thiophen-2-ylethanamine |
| SMILES | CC(C)N1CCN(CC(N)c2cccs2)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-11(2)16-7-5-15(6-8-16)10-12(14)13-4-3-9-17-13/h3-4,9,11-12H,5-8,10,14H2,1-2H3 |
| InChIKey | UJFPGZQQPNZTSO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |