C11H19N3O2S2 — CID 115287841
2-(4-methylsulfonylpiperazin-1-yl)-1-thiophen-2-ylethanamine (PubChem CID 115287841) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 2-(4-methylsulfonylpiperazin-1-yl)-1-thiophen-2-ylethanamine.
| Compound Name | 2-(4-methylsulfonylpiperazin-1-yl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 115287841 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(4-methylsulfonylpiperazin-1-yl)-1-thiophen-2-ylethanamine |
| SMILES | CS(=O)(=O)N1CCN(CC(N)c2cccs2)CC1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-18(15,16)14-6-4-13(5-7-14)9-10(12)11-3-2-8-17-11/h2-3,8,10H,4-7,9,12H2,1H3 |
| InChIKey | UGOYNAXPRZUERA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |