C13H23N3S — CID 51862509
(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine (PubChem CID 51862509) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is (1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine.
| Compound Name | (1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 51862509 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-amine |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@H](C)N)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-3-15-6-8-16(9-7-15)13(11(2)14)12-5-4-10-17-12/h4-5,10-11,13H,3,6-9,14H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | CDEBOFKFOMBSGS-AAEUAGOBSA-N |
| XLogP | 1.77 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |