C14H25BrN4S — CID 115380421
2-(3-bromothiophen-2-yl)-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanamine (PubChem CID 115380421) has the molecular formula C14H25BrN4S and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 115380421 |
| Molecular Formula | C14H25BrN4S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanamine |
| SMILES | CN(C)CCN1CCN(C(CN)c2sccc2Br)CC1 |
| InChI | InChI=1S/C14H25BrN4S/c1-17(2)4-5-18-6-8-19(9-7-18)13(11-16)14-12(15)3-10-20-14/h3,10,13H,4-9,11,16H2,1-2H3 |
| InChIKey | BKCNFAOIHIDFMJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |