C11H17BrN2S2 — CID 115380349
2-(3-bromothiophen-2-yl)-2-(1,4-thiazepan-4-yl)ethanamine (PubChem CID 115380349) has the molecular formula C11H17BrN2S2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(1,4-thiazepan-4-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(1,4-thiazepan-4-yl)ethanamine |
|---|---|
| PubChem CID | 115380349 |
| Molecular Formula | C11H17BrN2S2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(1,4-thiazepan-4-yl)ethanamine |
| SMILES | NCC(c1sccc1Br)N1CCCSCC1 |
| InChI | InChI=1S/C11H17BrN2S2/c12-9-2-6-16-11(9)10(8-13)14-3-1-5-15-7-4-14/h2,6,10H,1,3-5,7-8,13H2 |
| InChIKey | ZTGPKSDJBZVCHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |