C14H22BrN3OS — CID 115380442
2-(3-bromothiophen-2-yl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)ethanamine (PubChem CID 115380442) has the molecular formula C14H22BrN3OS and a molecular weight of 360.32 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 115380442 |
| Molecular Formula | C14H22BrN3OS |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)ethanamine |
| SMILES | NCC(c1sccc1Br)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C14H22BrN3OS/c15-12-2-8-20-14(12)13(9-16)18-3-1-11(10-18)17-4-6-19-7-5-17/h2,8,11,13H,1,3-7,9-10,16H2 |
| InChIKey | AHQIBWAWQKADSU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |