C11H17BrN2S2 — CID 115380460
2-(3-bromothiophen-2-yl)-2-(3-methylthiomorpholin-4-yl)ethanamine (PubChem CID 115380460) has the molecular formula C11H17BrN2S2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(3-methylthiomorpholin-4-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(3-methylthiomorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 115380460 |
| Molecular Formula | C11H17BrN2S2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(3-methylthiomorpholin-4-yl)ethanamine |
| SMILES | CC1CSCCN1C(CN)c1sccc1Br |
| InChI | InChI=1S/C11H17BrN2S2/c1-8-7-15-5-3-14(8)10(6-13)11-9(12)2-4-16-11/h2,4,8,10H,3,5-7,13H2,1H3 |
| InChIKey | SCIKIZHKDZIIPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |