C9H13BrN2S3 — CID 105249432
[(3-bromothiophen-2-yl)-(1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105249432) has the molecular formula C9H13BrN2S3 and a molecular weight of 325.32 g/mol. Its IUPAC name is [(3-bromothiophen-2-yl)-(1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromothiophen-2-yl)-(1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249432 |
| Molecular Formula | C9H13BrN2S3 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | [(3-bromothiophen-2-yl)-(1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | NNC(c1sccc1Br)C1CSCCS1 |
| InChI | InChI=1S/C9H13BrN2S3/c10-6-1-2-15-9(6)8(12-11)7-5-13-3-4-14-7/h1-2,7-8,12H,3-5,11H2 |
| InChIKey | FFEVUMNWXCIXTQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|