C10H14BrNS2 — CID 103902688
N-[1-(3-bromothiophen-2-yl)ethyl]thiolan-3-amine (PubChem CID 103902688) has the molecular formula C10H14BrNS2 and a molecular weight of 292.27 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]thiolan-3-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103902688 |
| Molecular Formula | C10H14BrNS2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]thiolan-3-amine |
| SMILES | CC(NC1CCSC1)c1sccc1Br |
| InChI | InChI=1S/C10H14BrNS2/c1-7(10-9(11)3-5-14-10)12-8-2-4-13-6-8/h3,5,7-8,12H,2,4,6H2,1H3 |
| InChIKey | UOCDMODAQAZZEB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |