C12H15BrFNS — CID 102613010
N-[1-(4-bromo-2-fluorophenyl)ethyl]thiolan-3-amine (PubChem CID 102613010) has the molecular formula C12H15BrFNS and a molecular weight of 304.23 g/mol. Its IUPAC name is N-[1-(4-bromo-2-fluorophenyl)ethyl]thiolan-3-amine.
| Compound Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 102613010 |
| Molecular Formula | C12H15BrFNS |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]thiolan-3-amine |
| SMILES | CC(NC1CCSC1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H15BrFNS/c1-8(15-10-4-5-16-7-10)11-3-2-9(13)6-12(11)14/h2-3,6,8,10,15H,4-5,7H2,1H3 |
| InChIKey | RZHZSCXSKXZWRS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |