C14H17BrFNO — CID 86804132
[(1R,4S)-4-[1-(4-bromo-2-fluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 86804132) has the molecular formula C14H17BrFNO and a molecular weight of 314.20 g/mol. Its IUPAC name is [(1R,4S)-4-[1-(4-bromo-2-fluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[1-(4-bromo-2-fluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86804132 |
| Molecular Formula | C14H17BrFNO |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | [(1R,4S)-4-[1-(4-bromo-2-fluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | CC(N[C@@H]1C=C[C@H](CO)C1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H17BrFNO/c1-9(13-5-3-11(15)7-14(13)16)17-12-4-2-10(6-12)8-18/h2-5,7,9-10,12,17-18H,6,8H2,1H3/t9?,10-,12+/m0/s1 |
| InChIKey | CXUGOEDRMDKTOM-OJBNZGHXSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|