C12H15BrFNO2S — CID 81422839
N-[1-(4-bromo-2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 81422839) has the molecular formula C12H15BrFNO2S and a molecular weight of 336.23 g/mol. Its IUPAC name is N-[1-(4-bromo-2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 81422839 |
| Molecular Formula | C12H15BrFNO2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H15BrFNO2S/c1-8(11-3-2-9(13)6-12(11)14)15-10-4-5-18(16,17)7-10/h2-3,6,8,10,15H,4-5,7H2,1H3 |
| InChIKey | UYIWUMUOSWJDOB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |