C13H19NO4S — CID 43190984
2-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4-methoxyphenol (PubChem CID 43190984) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4-methoxyphenol.
| Compound Name | 2-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 43190984 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C(C)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-9(14-10-5-6-19(16,17)8-10)12-7-11(18-2)3-4-13(12)15/h3-4,7,9-10,14-15H,5-6,8H2,1-2H3 |
| InChIKey | ZSNPYBFNYGAVMX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|