C13H17NO5S — CID 60975569
N-(1,1-dioxothian-4-yl)-2-hydroxy-5-methoxybenzamide (PubChem CID 60975569) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 60975569 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-19-10-2-3-12(15)11(8-10)13(16)14-9-4-6-20(17,18)7-5-9/h2-3,8-9,15H,4-7H2,1H3,(H,14,16) |
| InChIKey | OFYHCNSIYXGFEE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |