C14H19NO4S — CID 94801529
N-[(3R)-1,1-dioxothiolan-3-yl]-2-hydroxy-5-propan-2-ylbenzamide (PubChem CID 94801529) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-hydroxy-5-propan-2-ylbenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-hydroxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 94801529 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-hydroxy-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(O)c(C(=O)N[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-9(2)10-3-4-13(16)12(7-10)14(17)15-11-5-6-20(18,19)8-11/h3-4,7,9,11,16H,5-6,8H2,1-2H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | JYWIMURMABQXPS-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |